C21H19ClN6OS2 — CID 17102954
3-chloro-N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-4-methylbenzamide (PubChem CID 17102954) has the molecular formula C21H19ClN6OS2 and a molecular weight of 471.01 g/mol. Its IUPAC name is 3-chloro-N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-4-methylbenzamide.
| Compound Name | 3-chloro-N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 17102954 |
| Molecular Formula | C21H19ClN6OS2 |
| Molecular Weight | 471.01 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 3-chloro-N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-4-methylbenzamide |
| SMILES | CCc1nnc2sc(-c3ccc(CNC(=S)NC(=O)c4ccc(C)c(Cl)c4)cc3)nn12 |
| InChI | InChI=1S/C21H19ClN6OS2/c1-3-17-25-26-21-28(17)27-19(31-21)14-8-5-13(6-9-14)11-23-20(30)24-18(29)15-7-4-12(2)16(22)10-15/h4-10H,3,11H2,1-2H3,(H2,23,24,29,30) |
| InChIKey | FROQSOVEWCZWDC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.01 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|