C22H22N6O3S2 — CID 17112144
N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-3,4-dimethoxybenzamide (PubChem CID 17112144) has the molecular formula C22H22N6O3S2 and a molecular weight of 482.59 g/mol. Its IUPAC name is N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17112144 |
| Molecular Formula | C22H22N6O3S2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-3,4-dimethoxybenzamide |
| SMILES | CCc1nnc2sc(-c3ccc(CNC(=S)NC(=O)c4ccc(OC)c(OC)c4)cc3)nn12 |
| InChI | InChI=1S/C22H22N6O3S2/c1-4-18-25-26-22-28(18)27-20(33-22)14-7-5-13(6-8-14)12-23-21(32)24-19(29)15-9-10-16(30-2)17(11-15)31-3/h5-11H,4,12H2,1-3H3,(H2,23,24,29,32) |
| InChIKey | UNSVXKJRMLXDRX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|