C24H24N8O4S2 — CID 17314895
N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 17314895) has the molecular formula C24H24N8O4S2 and a molecular weight of 552.64 g/mol. Its IUPAC name is N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17314895 |
| Molecular Formula | C24H24N8O4S2 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | CCc1nnc2sc(-c3ccc(CNC(=S)NC(=O)c4ccc(N5CCOCC5)c([N+](=O)[O-])c4)cc3)nn12 |
| InChI | InChI=1S/C24H24N8O4S2/c1-2-20-27-28-24-31(20)29-22(38-24)16-5-3-15(4-6-16)14-25-23(37)26-21(33)17-7-8-18(19(13-17)32(34)35)30-9-11-36-12-10-30/h3-8,13H,2,9-12,14H2,1H3,(H2,25,26,33,37) |
| InChIKey | FGETYNIRZSXHQL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|