C21H19N7O4S — CID 17111540
N-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 17111540) has the molecular formula C21H19N7O4S and a molecular weight of 465.50 g/mol. Its IUPAC name is N-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17111540 |
| Molecular Formula | C21H19N7O4S |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | N-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | Cc1nnc2sc(-c3ccc(NC(=O)c4ccc(N5CCOCC5)c([N+](=O)[O-])c4)cc3)nn12 |
| InChI | InChI=1S/C21H19N7O4S/c1-13-23-24-21-27(13)25-20(33-21)14-2-5-16(6-3-14)22-19(29)15-4-7-17(18(12-15)28(30)31)26-8-10-32-11-9-26/h2-7,12H,8-11H2,1H3,(H,22,29) |
| InChIKey | FQCAFCGMWNNUNV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|