C23H25N7O4S2 — CID 17314892
N-[(3-benzylsulfanyl-5-ethyl-1,2,4-triazol-4-yl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 17314892) has the molecular formula C23H25N7O4S2 and a molecular weight of 527.63 g/mol. Its IUPAC name is N-[(3-benzylsulfanyl-5-ethyl-1,2,4-triazol-4-yl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[(3-benzylsulfanyl-5-ethyl-1,2,4-triazol-4-yl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17314892 |
| Molecular Formula | C23H25N7O4S2 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | N-[(3-benzylsulfanyl-5-ethyl-1,2,4-triazol-4-yl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | CCc1nnc(SCc2ccccc2)n1NC(=S)NC(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H25N7O4S2/c1-2-20-25-26-23(36-15-16-6-4-3-5-7-16)29(20)27-22(35)24-21(31)17-8-9-18(19(14-17)30(32)33)28-10-12-34-13-11-28/h3-9,14H,2,10-13,15H2,1H3,(H2,24,27,31,35) |
| InChIKey | WDGJWRLBXAIRQF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|