C20H17ClN6O2S2 — CID 5034588
5-chloro-N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 5034588) has the molecular formula C20H17ClN6O2S2 and a molecular weight of 472.98 g/mol. Its IUPAC name is 5-chloro-N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 5034588 |
| Molecular Formula | C20H17ClN6O2S2 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 5-chloro-N-[[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | CCc1nnc2sc(-c3ccc(NC(=S)NC(=O)c4cc(Cl)ccc4OC)cc3)nn12 |
| InChI | InChI=1S/C20H17ClN6O2S2/c1-3-16-24-25-20-27(16)26-18(31-20)11-4-7-13(8-5-11)22-19(30)23-17(28)14-10-12(21)6-9-15(14)29-2/h4-10H,3H2,1-2H3,(H2,22,23,28,30) |
| InChIKey | SFZHBZCOYTXZEG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|