C20H19N5O3S — CID 4992491
N-[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-2,6-dimethoxybenzamide (PubChem CID 4992491) has the molecular formula C20H19N5O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is N-[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 4992491 |
| Molecular Formula | C20H19N5O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[4-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-2,6-dimethoxybenzamide |
| SMILES | CCc1nnc2sc(-c3ccc(NC(=O)c4c(OC)cccc4OC)cc3)nn12 |
| InChI | InChI=1S/C20H19N5O3S/c1-4-16-22-23-20-25(16)24-19(29-20)12-8-10-13(11-9-12)21-18(26)17-14(27-2)6-5-7-15(17)28-3/h5-11H,4H2,1-3H3,(H,21,26) |
| InChIKey | LBVBNJIZTSBQIS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |