C20H24ClN3O2S — CID 19631475
5-chloro-N-[[4-(diethylaminomethyl)phenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 19631475) has the molecular formula C20H24ClN3O2S and a molecular weight of 405.95 g/mol. Its IUPAC name is 5-chloro-N-[[4-(diethylaminomethyl)phenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[[4-(diethylaminomethyl)phenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 19631475 |
| Molecular Formula | C20H24ClN3O2S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 5-chloro-N-[[4-(diethylaminomethyl)phenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | CCN(CC)Cc1ccc(NC(=S)NC(=O)c2cc(Cl)ccc2OC)cc1 |
| InChI | InChI=1S/C20H24ClN3O2S/c1-4-24(5-2)13-14-6-9-16(10-7-14)22-20(27)23-19(25)17-12-15(21)8-11-18(17)26-3/h6-12H,4-5,13H2,1-3H3,(H2,22,23,25,27) |
| InChIKey | XMJSQVWNUKPFNP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|