C21H27N3O3S — CID 19631083
N-[[4-(diethylaminomethyl)phenyl]carbamothioyl]-2,6-dimethoxybenzamide (PubChem CID 19631083) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is N-[[4-(diethylaminomethyl)phenyl]carbamothioyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[[4-(diethylaminomethyl)phenyl]carbamothioyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 19631083 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[[4-(diethylaminomethyl)phenyl]carbamothioyl]-2,6-dimethoxybenzamide |
| SMILES | CCN(CC)Cc1ccc(NC(=S)NC(=O)c2c(OC)cccc2OC)cc1 |
| InChI | InChI=1S/C21H27N3O3S/c1-5-24(6-2)14-15-10-12-16(13-11-15)22-21(28)23-20(25)19-17(26-3)8-7-9-18(19)27-4/h7-13H,5-6,14H2,1-4H3,(H2,22,23,25,28) |
| InChIKey | RACPEIAHLZFISX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|