C11H13NO3S — CID 849614
N-ethanethioyl-2,6-dimethoxybenzamide (PubChem CID 849614) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is N-ethanethioyl-2,6-dimethoxybenzamide.
| Compound Name | N-ethanethioyl-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 849614 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | N-ethanethioyl-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(C)=S |
| InChI | InChI=1S/C11H13NO3S/c1-7(16)12-11(13)10-8(14-2)5-4-6-9(10)15-3/h4-6H,1-3H3,(H,12,13,16) |
| InChIKey | JYZXAFTYHAOCSR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|