C16H16N2O4S — CID 954653
N-[(2-hydroxyphenyl)carbamothioyl]-2,6-dimethoxybenzamide (PubChem CID 954653) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is N-[(2-hydroxyphenyl)carbamothioyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[(2-hydroxyphenyl)carbamothioyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 954653 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | N-[(2-hydroxyphenyl)carbamothioyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(=S)Nc1ccccc1O |
| InChI | InChI=1S/C16H16N2O4S/c1-21-12-8-5-9-13(22-2)14(12)15(20)18-16(23)17-10-6-3-4-7-11(10)19/h3-9,19H,1-2H3,(H2,17,18,20,23) |
| InChIKey | DZEPKCKCEYATRA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|