C9H10N2O2S — CID 13109787
N-[(2-hydroxyphenyl)carbamothioyl]acetamide (PubChem CID 13109787) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is N-[(2-hydroxyphenyl)carbamothioyl]acetamide.
| Compound Name | N-[(2-hydroxyphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 13109787 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | N-[(2-hydroxyphenyl)carbamothioyl]acetamide |
| SMILES | CC(=O)NC(=S)Nc1ccccc1O |
| InChI | InChI=1S/C9H10N2O2S/c1-6(12)10-9(14)11-7-4-2-3-5-8(7)13/h2-5,13H,1H3,(H2,10,11,12,14) |
| InChIKey | ZIZPBYCWCHDDNV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|