C19H20N4O4S2 — CID 22779683
N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-2,6-dimethoxybenzamide (PubChem CID 22779683) has the molecular formula C19H20N4O4S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 22779683 |
| Molecular Formula | C19H20N4O4S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(=S)Nc1ccc(NC(=S)NC(C)=O)cc1 |
| InChI | InChI=1S/C19H20N4O4S2/c1-11(24)20-18(28)21-12-7-9-13(10-8-12)22-19(29)23-17(25)16-14(26-2)5-4-6-15(16)27-3/h4-10H,1-3H3,(H2,20,21,24,28)(H2,22,23,25,29) |
| InChIKey | BKRNHCQPUZJPEU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|