C18H19IN2O3S — CID 17335731
N-[(4-iodo-3,5-dimethylphenyl)carbamothioyl]-2,6-dimethoxybenzamide (PubChem CID 17335731) has the molecular formula C18H19IN2O3S and a molecular weight of 470.33 g/mol. Its IUPAC name is N-[(4-iodo-3,5-dimethylphenyl)carbamothioyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[(4-iodo-3,5-dimethylphenyl)carbamothioyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 17335731 |
| Molecular Formula | C18H19IN2O3S |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | N-[(4-iodo-3,5-dimethylphenyl)carbamothioyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(=S)Nc1cc(C)c(I)c(C)c1 |
| InChI | InChI=1S/C18H19IN2O3S/c1-10-8-12(9-11(2)16(10)19)20-18(25)21-17(22)15-13(23-3)6-5-7-14(15)24-4/h5-9H,1-4H3,(H2,20,21,22,25) |
| InChIKey | IXSZXUPVAOEXGA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|