C23H19Cl2N3O4S — CID 23100463
N-[[3-[(2,4-dichlorobenzoyl)amino]phenyl]carbamothioyl]-2,6-dimethoxybenzamide (PubChem CID 23100463) has the molecular formula C23H19Cl2N3O4S and a molecular weight of 504.40 g/mol. Its IUPAC name is N-[[3-[(2,4-dichlorobenzoyl)amino]phenyl]carbamothioyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[[3-[(2,4-dichlorobenzoyl)amino]phenyl]carbamothioyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 23100463 |
| Molecular Formula | C23H19Cl2N3O4S |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | N-[[3-[(2,4-dichlorobenzoyl)amino]phenyl]carbamothioyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(=S)Nc1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C23H19Cl2N3O4S/c1-31-18-7-4-8-19(32-2)20(18)22(30)28-23(33)27-15-6-3-5-14(12-15)26-21(29)16-10-9-13(24)11-17(16)25/h3-12H,1-2H3,(H,26,29)(H2,27,28,30,33) |
| InChIKey | DLYXMZLVOYWWRJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|