C17H16Cl2N2O3S — CID 17169954
2,4-dichloro-N-[[3-(2-methoxyethoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17169954) has the molecular formula C17H16Cl2N2O3S and a molecular weight of 399.30 g/mol. Its IUPAC name is 2,4-dichloro-N-[[3-(2-methoxyethoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[3-(2-methoxyethoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17169954 |
| Molecular Formula | C17H16Cl2N2O3S |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 2,4-dichloro-N-[[3-(2-methoxyethoxy)phenyl]carbamothioyl]benzamide |
| SMILES | COCCOc1cccc(NC(=S)NC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2O3S/c1-23-7-8-24-13-4-2-3-12(10-13)20-17(25)21-16(22)14-6-5-11(18)9-15(14)19/h2-6,9-10H,7-8H2,1H3,(H2,20,21,22,25) |
| InChIKey | VFAACWXVBVIUCA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|