C16H16ClNO3 — CID 17169773
2-chloro-N-[3-(2-methoxyethoxy)phenyl]benzamide (PubChem CID 17169773) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is 2-chloro-N-[3-(2-methoxyethoxy)phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-(2-methoxyethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 17169773 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-chloro-N-[3-(2-methoxyethoxy)phenyl]benzamide |
| SMILES | COCCOc1cccc(NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C16H16ClNO3/c1-20-9-10-21-13-6-4-5-12(11-13)18-16(19)14-7-2-3-8-15(14)17/h2-8,11H,9-10H2,1H3,(H,18,19) |
| InChIKey | HXXCWGNSMIFYTA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|