C19H21NO5S — CID 120690684
2-[2-[[3-(2-methoxyethoxy)phenyl]carbamoyl]phenyl]sulfanylpropanoic acid (PubChem CID 120690684) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-[2-[[3-(2-methoxyethoxy)phenyl]carbamoyl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-[2-[[3-(2-methoxyethoxy)phenyl]carbamoyl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 120690684 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-[2-[[3-(2-methoxyethoxy)phenyl]carbamoyl]phenyl]sulfanylpropanoic acid |
| SMILES | COCCOc1cccc(NC(=O)c2ccccc2SC(C)C(=O)O)c1 |
| InChI | InChI=1S/C19H21NO5S/c1-13(19(22)23)26-17-9-4-3-8-16(17)18(21)20-14-6-5-7-15(12-14)25-11-10-24-2/h3-9,12-13H,10-11H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | RGYJCSXFJSHCPE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|