C21H25NO4S — CID 119180502
2-[2-[(3-butoxyphenyl)methylcarbamoyl]phenyl]sulfanylpropanoic acid (PubChem CID 119180502) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is 2-[2-[(3-butoxyphenyl)methylcarbamoyl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-[2-[(3-butoxyphenyl)methylcarbamoyl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 119180502 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-[2-[(3-butoxyphenyl)methylcarbamoyl]phenyl]sulfanylpropanoic acid |
| SMILES | CCCCOc1cccc(CNC(=O)c2ccccc2SC(C)C(=O)O)c1 |
| InChI | InChI=1S/C21H25NO4S/c1-3-4-12-26-17-9-7-8-16(13-17)14-22-20(23)18-10-5-6-11-19(18)27-15(2)21(24)25/h5-11,13,15H,3-4,12,14H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | PZGSOBMGTYPENB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|