C20H23NO5S — CID 119182076
2-[2-[[2-(2-methoxyethoxy)phenyl]methylcarbamoyl]phenyl]sulfanylpropanoic acid (PubChem CID 119182076) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is 2-[2-[[2-(2-methoxyethoxy)phenyl]methylcarbamoyl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-[2-[[2-(2-methoxyethoxy)phenyl]methylcarbamoyl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 119182076 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[2-[[2-(2-methoxyethoxy)phenyl]methylcarbamoyl]phenyl]sulfanylpropanoic acid |
| SMILES | COCCOc1ccccc1CNC(=O)c1ccccc1SC(C)C(=O)O |
| InChI | InChI=1S/C20H23NO5S/c1-14(20(23)24)27-18-10-6-4-8-16(18)19(22)21-13-15-7-3-5-9-17(15)26-12-11-25-2/h3-10,14H,11-13H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | IGDHQLOITJXBAN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|