C18H19F2NO4S — CID 18196193
2-(difluoromethylsulfanyl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide (PubChem CID 18196193) has the molecular formula C18H19F2NO4S and a molecular weight of 383.42 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 18196193 |
| Molecular Formula | C18H19F2NO4S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)c1ccccc1SC(F)F |
| InChI | InChI=1S/C18H19F2NO4S/c1-23-13-9-15(25-3)14(24-2)8-11(13)10-21-17(22)12-6-4-5-7-16(12)26-18(19)20/h4-9,18H,10H2,1-3H3,(H,21,22) |
| InChIKey | APMMEGHJMWESJV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |