C19H23NO5S — CID 11945350
2-[(S)-ethylsulfinyl]-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide (PubChem CID 11945350) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is 2-[(S)-ethylsulfinyl]-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide.
| Compound Name | 2-[(S)-ethylsulfinyl]-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 11945350 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-[(S)-ethylsulfinyl]-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide |
| SMILES | CC[S@](=O)c1ccccc1C(=O)NCc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C19H23NO5S/c1-5-26(22)18-9-7-6-8-14(18)19(21)20-12-13-10-16(24-3)17(25-4)11-15(13)23-2/h6-11H,5,12H2,1-4H3,(H,20,21)/t26-/m0/s1 |
| InChIKey | HPIPTYCSSXSPDJ-SANMLTNESA-N |
| XLogP | 2.77 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |