C17H17F2NO2S — CID 146085028
N-[2-(2,6-difluorophenyl)ethyl]-2-ethylsulfinylbenzamide (PubChem CID 146085028) has the molecular formula C17H17F2NO2S and a molecular weight of 337.39 g/mol. Its IUPAC name is N-[2-(2,6-difluorophenyl)ethyl]-2-ethylsulfinylbenzamide.
| Compound Name | N-[2-(2,6-difluorophenyl)ethyl]-2-ethylsulfinylbenzamide |
|---|---|
| PubChem CID | 146085028 |
| Molecular Formula | C17H17F2NO2S |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-[2-(2,6-difluorophenyl)ethyl]-2-ethylsulfinylbenzamide |
| SMILES | CCS(=O)c1ccccc1C(=O)NCCc1c(F)cccc1F |
| InChI | InChI=1S/C17H17F2NO2S/c1-2-23(22)16-9-4-3-6-13(16)17(21)20-11-10-12-14(18)7-5-8-15(12)19/h3-9H,2,10-11H2,1H3,(H,20,21) |
| InChIKey | DVHHYWPGGPBRCX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |