C8H8F2OS — CID 66796026
1-ethylsulfinyl-2,3-difluorobenzene (PubChem CID 66796026) has the molecular formula C8H8F2OS and a molecular weight of 190.21 g/mol. Its IUPAC name is 1-ethylsulfinyl-2,3-difluorobenzene.
| Compound Name | 1-ethylsulfinyl-2,3-difluorobenzene |
|---|---|
| PubChem CID | 66796026 |
| Molecular Formula | C8H8F2OS |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 1-ethylsulfinyl-2,3-difluorobenzene |
| SMILES | CCS(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C8H8F2OS/c1-2-12(11)7-5-3-4-6(9)8(7)10/h3-5H,2H2,1H3 |
| InChIKey | DQOOLBOGKRECNB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |