C21H21F2N3O — CID 78892567
1-benzyl-N-[2-(2,6-difluorophenyl)ethyl]-5-ethylpyrazole-4-carboxamide (PubChem CID 78892567) has the molecular formula C21H21F2N3O and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-benzyl-N-[2-(2,6-difluorophenyl)ethyl]-5-ethylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[2-(2,6-difluorophenyl)ethyl]-5-ethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 78892567 |
| Molecular Formula | C21H21F2N3O |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-benzyl-N-[2-(2,6-difluorophenyl)ethyl]-5-ethylpyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NCCc2c(F)cccc2F)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C21H21F2N3O/c1-2-20-17(13-25-26(20)14-15-7-4-3-5-8-15)21(27)24-12-11-16-18(22)9-6-10-19(16)23/h3-10,13H,2,11-12,14H2,1H3,(H,24,27) |
| InChIKey | VDBARUUJCKLWPI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |