C23H28N4O3S — CID 78872572
1-benzyl-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-5-ethylpyrazole-4-carboxamide (PubChem CID 78872572) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is 1-benzyl-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-5-ethylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-5-ethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 78872572 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 1-benzyl-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-5-ethylpyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NCCNS(=O)(=O)c2cc(C)ccc2C)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C23H28N4O3S/c1-4-21-20(15-25-27(21)16-19-8-6-5-7-9-19)23(28)24-12-13-26-31(29,30)22-14-17(2)10-11-18(22)3/h5-11,14-15,26H,4,12-13,16H2,1-3H3,(H,24,28) |
| InChIKey | VQVFHIYQIRPMSK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|