C23H26N4O3 — CID 78872517
1-benzyl-N'-[2-(3,4-dimethylphenoxy)acetyl]-5-ethylpyrazole-4-carbohydrazide (PubChem CID 78872517) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-benzyl-N'-[2-(3,4-dimethylphenoxy)acetyl]-5-ethylpyrazole-4-carbohydrazide.
| Compound Name | 1-benzyl-N'-[2-(3,4-dimethylphenoxy)acetyl]-5-ethylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 78872517 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 1-benzyl-N'-[2-(3,4-dimethylphenoxy)acetyl]-5-ethylpyrazole-4-carbohydrazide |
| SMILES | CCc1c(C(=O)NNC(=O)COc2ccc(C)c(C)c2)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C23H26N4O3/c1-4-21-20(13-24-27(21)14-18-8-6-5-7-9-18)23(29)26-25-22(28)15-30-19-11-10-16(2)17(3)12-19/h5-13H,4,14-15H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | RZQYJMZJXLXXLT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|