C25H24N4O4 — CID 78872608
1-benzyl-5-ethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]pyrazole-4-carbohydrazide (PubChem CID 78872608) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 1-benzyl-5-ethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]pyrazole-4-carbohydrazide.
| Compound Name | 1-benzyl-5-ethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 78872608 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-benzyl-5-ethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]pyrazole-4-carbohydrazide |
| SMILES | CCc1c(C(=O)NNC(=O)c2ccc(COc3ccccc3)o2)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C25H24N4O4/c1-2-22-21(15-26-29(22)16-18-9-5-3-6-10-18)24(30)27-28-25(31)23-14-13-20(33-23)17-32-19-11-7-4-8-12-19/h3-15H,2,16-17H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | HURQQKNIOKJEGX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|