C25H23ClN4O4 — CID 46671540
1-(4-chlorophenyl)-N'-[5-(phenoxymethyl)furan-2-carbonyl]-5-propan-2-ylpyrazole-4-carbohydrazide (PubChem CID 46671540) has the molecular formula C25H23ClN4O4 and a molecular weight of 478.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N'-[5-(phenoxymethyl)furan-2-carbonyl]-5-propan-2-ylpyrazole-4-carbohydrazide.
| Compound Name | 1-(4-chlorophenyl)-N'-[5-(phenoxymethyl)furan-2-carbonyl]-5-propan-2-ylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 46671540 |
| Molecular Formula | C25H23ClN4O4 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 1-(4-chlorophenyl)-N'-[5-(phenoxymethyl)furan-2-carbonyl]-5-propan-2-ylpyrazole-4-carbohydrazide |
| SMILES | CC(C)c1c(C(=O)NNC(=O)c2ccc(COc3ccccc3)o2)cnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H23ClN4O4/c1-16(2)23-21(14-27-30(23)18-10-8-17(26)9-11-18)24(31)28-29-25(32)22-13-12-20(34-22)15-33-19-6-4-3-5-7-19/h3-14,16H,15H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | BAAMRKUHAQCKDN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|