C19H13Cl2FN2O4 — CID 46656994
N'-(2,4-dichloro-5-fluorobenzoyl)-5-(phenoxymethyl)furan-2-carbohydrazide (PubChem CID 46656994) has the molecular formula C19H13Cl2FN2O4 and a molecular weight of 423.23 g/mol. Its IUPAC name is N'-(2,4-dichloro-5-fluorobenzoyl)-5-(phenoxymethyl)furan-2-carbohydrazide.
| Compound Name | N'-(2,4-dichloro-5-fluorobenzoyl)-5-(phenoxymethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 46656994 |
| Molecular Formula | C19H13Cl2FN2O4 |
| Molecular Weight | 423.23 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | N'-(2,4-dichloro-5-fluorobenzoyl)-5-(phenoxymethyl)furan-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(F)c(Cl)cc1Cl)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C19H13Cl2FN2O4/c20-14-9-15(21)16(22)8-13(14)18(25)23-24-19(26)17-7-6-12(28-17)10-27-11-4-2-1-3-5-11/h1-9H,10H2,(H,23,25)(H,24,26) |
| InChIKey | LMIILIQRWOVCIW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.23 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|