C19H15F2N3O4S — CID 24553921
2-(difluoromethylsulfanyl)-N'-[5-(phenoxymethyl)furan-2-carbonyl]pyridine-3-carbohydrazide (PubChem CID 24553921) has the molecular formula C19H15F2N3O4S and a molecular weight of 419.41 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N'-[5-(phenoxymethyl)furan-2-carbonyl]pyridine-3-carbohydrazide.
| Compound Name | 2-(difluoromethylsulfanyl)-N'-[5-(phenoxymethyl)furan-2-carbonyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 24553921 |
| Molecular Formula | C19H15F2N3O4S |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N'-[5-(phenoxymethyl)furan-2-carbonyl]pyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cccnc1SC(F)F)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C19H15F2N3O4S/c20-19(21)29-18-14(7-4-10-22-18)16(25)23-24-17(26)15-9-8-13(28-15)11-27-12-5-2-1-3-6-12/h1-10,19H,11H2,(H,23,25)(H,24,26) |
| InChIKey | ULODKIRAOJGONO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|