C23H20N4O5S — CID 33007347
N'-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoyl]-5-(phenoxymethyl)furan-2-carbohydrazide (PubChem CID 33007347) has the molecular formula C23H20N4O5S and a molecular weight of 464.50 g/mol. Its IUPAC name is N'-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoyl]-5-(phenoxymethyl)furan-2-carbohydrazide.
| Compound Name | N'-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 33007347 |
| Molecular Formula | C23H20N4O5S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | N'-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
| SMILES | Cc1noc(CSc2ccccc2C(=O)NNC(=O)c2ccc(COc3ccccc3)o2)n1 |
| InChI | InChI=1S/C23H20N4O5S/c1-15-24-21(32-27-15)14-33-20-10-6-5-9-18(20)22(28)25-26-23(29)19-12-11-17(31-19)13-30-16-7-3-2-4-8-16/h2-12H,13-14H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | LQEFSKHGYVBJSS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|