C19H15FN2O4 — CID 4795196
N'-(2-fluorobenzoyl)-5-(phenoxymethyl)furan-2-carbohydrazide (PubChem CID 4795196) has the molecular formula C19H15FN2O4 and a molecular weight of 354.34 g/mol. Its IUPAC name is N'-(2-fluorobenzoyl)-5-(phenoxymethyl)furan-2-carbohydrazide.
| Compound Name | N'-(2-fluorobenzoyl)-5-(phenoxymethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 4795196 |
| Molecular Formula | C19H15FN2O4 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N'-(2-fluorobenzoyl)-5-(phenoxymethyl)furan-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1F)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C19H15FN2O4/c20-16-9-5-4-8-15(16)18(23)21-22-19(24)17-11-10-14(26-17)12-25-13-6-2-1-3-7-13/h1-11H,12H2,(H,21,23)(H,22,24) |
| InChIKey | JLDDNBFMANWJDQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|