C19H15FN2O4 — CID 39213699
N-(3-carbamoyl-4-fluorophenyl)-5-(phenoxymethyl)furan-2-carboxamide (PubChem CID 39213699) has the molecular formula C19H15FN2O4 and a molecular weight of 354.34 g/mol. Its IUPAC name is N-(3-carbamoyl-4-fluorophenyl)-5-(phenoxymethyl)furan-2-carboxamide.
| Compound Name | N-(3-carbamoyl-4-fluorophenyl)-5-(phenoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 39213699 |
| Molecular Formula | C19H15FN2O4 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N-(3-carbamoyl-4-fluorophenyl)-5-(phenoxymethyl)furan-2-carboxamide |
| SMILES | NC(=O)c1cc(NC(=O)c2ccc(COc3ccccc3)o2)ccc1F |
| InChI | InChI=1S/C19H15FN2O4/c20-16-8-6-12(10-15(16)18(21)23)22-19(24)17-9-7-14(26-17)11-25-13-4-2-1-3-5-13/h1-10H,11H2,(H2,21,23)(H,22,24) |
| InChIKey | TUBSSYWJGCBZJE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |