C27H24N2O5 — CID 26774462
N-[4-[(4-ethoxyphenyl)carbamoyl]phenyl]-5-(phenoxymethyl)furan-2-carboxamide (PubChem CID 26774462) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is N-[4-[(4-ethoxyphenyl)carbamoyl]phenyl]-5-(phenoxymethyl)furan-2-carboxamide.
| Compound Name | N-[4-[(4-ethoxyphenyl)carbamoyl]phenyl]-5-(phenoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 26774462 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-[4-[(4-ethoxyphenyl)carbamoyl]phenyl]-5-(phenoxymethyl)furan-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(NC(=O)c3ccc(COc4ccccc4)o3)cc2)cc1 |
| InChI | InChI=1S/C27H24N2O5/c1-2-32-23-14-12-21(13-15-23)28-26(30)19-8-10-20(11-9-19)29-27(31)25-17-16-24(34-25)18-33-22-6-4-3-5-7-22/h3-17H,2,18H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | BXZCYRKKHKEHMD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |