C22H22N2O6 — CID 9219862
N'-[2-(4-ethoxyphenoxy)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide (PubChem CID 9219862) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is N'-[2-(4-ethoxyphenoxy)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide.
| Compound Name | N'-[2-(4-ethoxyphenoxy)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 9219862 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N'-[2-(4-ethoxyphenoxy)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
| SMILES | CCOc1ccc(OCC(=O)NNC(=O)c2ccc(COc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C22H22N2O6/c1-2-27-17-8-10-18(11-9-17)29-15-21(25)23-24-22(26)20-13-12-19(30-20)14-28-16-6-4-3-5-7-16/h3-13H,2,14-15H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | YBXIKHXKZDMWBC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|