C22H22N2O5 — CID 31837131
N'-(4-phenoxybutanoyl)-5-(phenoxymethyl)furan-2-carbohydrazide (PubChem CID 31837131) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is N'-(4-phenoxybutanoyl)-5-(phenoxymethyl)furan-2-carbohydrazide.
| Compound Name | N'-(4-phenoxybutanoyl)-5-(phenoxymethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 31837131 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N'-(4-phenoxybutanoyl)-5-(phenoxymethyl)furan-2-carbohydrazide |
| SMILES | O=C(CCCOc1ccccc1)NNC(=O)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C22H22N2O5/c25-21(12-7-15-27-17-8-3-1-4-9-17)23-24-22(26)20-14-13-19(29-20)16-28-18-10-5-2-6-11-18/h1-6,8-11,13-14H,7,12,15-16H2,(H,23,25)(H,24,26) |
| InChIKey | MECRDKQGRRDBDR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|