C24H23N3O4S — CID 31837485
N'-[5-(1,3-benzothiazol-2-yl)pentanoyl]-5-(phenoxymethyl)furan-2-carbohydrazide (PubChem CID 31837485) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is N'-[5-(1,3-benzothiazol-2-yl)pentanoyl]-5-(phenoxymethyl)furan-2-carbohydrazide.
| Compound Name | N'-[5-(1,3-benzothiazol-2-yl)pentanoyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 31837485 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N'-[5-(1,3-benzothiazol-2-yl)pentanoyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
| SMILES | O=C(CCCCc1nc2ccccc2s1)NNC(=O)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C24H23N3O4S/c28-22(12-6-7-13-23-25-19-10-4-5-11-21(19)32-23)26-27-24(29)20-15-14-18(31-20)16-30-17-8-2-1-3-9-17/h1-5,8-11,14-15H,6-7,12-13,16H2,(H,26,28)(H,27,29) |
| InChIKey | YECAJMQGDPYQGI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|