C21H19N5O2S — CID 27689131
N'-[4-(1,3-benzothiazol-2-yl)butanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 27689131) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is N'-[4-(1,3-benzothiazol-2-yl)butanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-[4-(1,3-benzothiazol-2-yl)butanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 27689131 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N'-[4-(1,3-benzothiazol-2-yl)butanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(CCCc1nc2ccccc2s1)NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C21H19N5O2S/c27-19(11-6-12-20-22-15-9-4-5-10-18(15)29-20)25-26-21(28)17-13-16(23-24-17)14-7-2-1-3-8-14/h1-5,7-10,13H,6,11-12H2,(H,23,24)(H,25,27)(H,26,28) |
| InChIKey | SRAHNJPLRYOHLR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|