C19H18ClN3O3S — CID 32932403
N'-[4-(1,3-benzothiazol-2-yl)butanoyl]-4-chloro-2-methoxybenzohydrazide (PubChem CID 32932403) has the molecular formula C19H18ClN3O3S and a molecular weight of 403.89 g/mol. Its IUPAC name is N'-[4-(1,3-benzothiazol-2-yl)butanoyl]-4-chloro-2-methoxybenzohydrazide.
| Compound Name | N'-[4-(1,3-benzothiazol-2-yl)butanoyl]-4-chloro-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 32932403 |
| Molecular Formula | C19H18ClN3O3S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N'-[4-(1,3-benzothiazol-2-yl)butanoyl]-4-chloro-2-methoxybenzohydrazide |
| SMILES | COc1cc(Cl)ccc1C(=O)NNC(=O)CCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H18ClN3O3S/c1-26-15-11-12(20)9-10-13(15)19(25)23-22-17(24)7-4-8-18-21-14-5-2-3-6-16(14)27-18/h2-3,5-6,9-11H,4,7-8H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | PTJKROKFVVNCHK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|