C20H19N3O4S — CID 3881152
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate (PubChem CID 3881152) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate |
|---|---|
| PubChem CID | 3881152 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate |
| SMILES | O=C(COC(=O)CCCc1nc2ccccc2s1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19N3O4S/c24-17(22-23-20(26)14-7-2-1-3-8-14)13-27-19(25)12-6-11-18-21-15-9-4-5-10-16(15)28-18/h1-5,7-10H,6,11-13H2,(H,22,24)(H,23,26) |
| InChIKey | HJRRPPHGNKHNRS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|