C22H24N2O3S — CID 7896108
[2-oxo-2-(3-phenylpropylamino)ethyl] 4-(1,3-benzothiazol-2-yl)butanoate (PubChem CID 7896108) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is [2-oxo-2-(3-phenylpropylamino)ethyl] 4-(1,3-benzothiazol-2-yl)butanoate.
| Compound Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 4-(1,3-benzothiazol-2-yl)butanoate |
|---|---|
| PubChem CID | 7896108 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 4-(1,3-benzothiazol-2-yl)butanoate |
| SMILES | O=C(COC(=O)CCCc1nc2ccccc2s1)NCCCc1ccccc1 |
| InChI | InChI=1S/C22H24N2O3S/c25-20(23-15-7-10-17-8-2-1-3-9-17)16-27-22(26)14-6-13-21-24-18-11-4-5-12-19(18)28-21/h1-5,8-9,11-12H,6-7,10,13-16H2,(H,23,25) |
| InChIKey | YBYGUMVMOQYWOJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|