C22H25N3O4S — CID 25443132
N'-[4-(1,3-benzothiazol-2-yl)butanoyl]-3-methoxy-4-propoxybenzohydrazide (PubChem CID 25443132) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is N'-[4-(1,3-benzothiazol-2-yl)butanoyl]-3-methoxy-4-propoxybenzohydrazide.
| Compound Name | N'-[4-(1,3-benzothiazol-2-yl)butanoyl]-3-methoxy-4-propoxybenzohydrazide |
|---|---|
| PubChem CID | 25443132 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N'-[4-(1,3-benzothiazol-2-yl)butanoyl]-3-methoxy-4-propoxybenzohydrazide |
| SMILES | CCCOc1ccc(C(=O)NNC(=O)CCCc2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C22H25N3O4S/c1-3-13-29-17-12-11-15(14-18(17)28-2)22(27)25-24-20(26)9-6-10-21-23-16-7-4-5-8-19(16)30-21/h4-5,7-8,11-12,14H,3,6,9-10,13H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | FJXOCTYPLJUZLZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|