C22H23N3O4 — CID 26621803
N'-(3-methoxy-4-propoxybenzoyl)-2-methylquinoline-4-carbohydrazide (PubChem CID 26621803) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N'-(3-methoxy-4-propoxybenzoyl)-2-methylquinoline-4-carbohydrazide.
| Compound Name | N'-(3-methoxy-4-propoxybenzoyl)-2-methylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 26621803 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N'-(3-methoxy-4-propoxybenzoyl)-2-methylquinoline-4-carbohydrazide |
| SMILES | CCCOc1ccc(C(=O)NNC(=O)c2cc(C)nc3ccccc23)cc1OC |
| InChI | InChI=1S/C22H23N3O4/c1-4-11-29-19-10-9-15(13-20(19)28-3)21(26)24-25-22(27)17-12-14(2)23-18-8-6-5-7-16(17)18/h5-10,12-13H,4,11H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | VYZUZYQILNNQDC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|