C25H27N3O4 — CID 24531698
N'-(4-butoxy-3-methoxybenzoyl)-2-methyl-6-phenylpyridine-3-carbohydrazide (PubChem CID 24531698) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is N'-(4-butoxy-3-methoxybenzoyl)-2-methyl-6-phenylpyridine-3-carbohydrazide.
| Compound Name | N'-(4-butoxy-3-methoxybenzoyl)-2-methyl-6-phenylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 24531698 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N'-(4-butoxy-3-methoxybenzoyl)-2-methyl-6-phenylpyridine-3-carbohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)c2ccc(-c3ccccc3)nc2C)cc1OC |
| InChI | InChI=1S/C25H27N3O4/c1-4-5-15-32-22-14-11-19(16-23(22)31-3)24(29)27-28-25(30)20-12-13-21(26-17(20)2)18-9-7-6-8-10-18/h6-14,16H,4-5,15H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | QHZCJVIPMVLWDN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|