C27H27N5O4 — CID 25442499
N'-(4-butoxy-3-methoxybenzoyl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carbohydrazide (PubChem CID 25442499) has the molecular formula C27H27N5O4 and a molecular weight of 485.54 g/mol. Its IUPAC name is N'-(4-butoxy-3-methoxybenzoyl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carbohydrazide.
| Compound Name | N'-(4-butoxy-3-methoxybenzoyl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 25442499 |
| Molecular Formula | C27H27N5O4 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | N'-(4-butoxy-3-methoxybenzoyl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carbohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)c2cn(-c3ccccc3)nc2-c2cccnc2)cc1OC |
| InChI | InChI=1S/C27H27N5O4/c1-3-4-15-36-23-13-12-19(16-24(23)35-2)26(33)29-30-27(34)22-18-32(21-10-6-5-7-11-21)31-25(22)20-9-8-14-28-17-20/h5-14,16-18H,3-4,15H2,1-2H3,(H,29,33)(H,30,34) |
| InChIKey | LMNFHFQEQZSCLC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|