C24H20N4O3 — CID 2381703
methyl 4-[[(1-phenyl-3-pyridin-3-ylpyrazole-4-carbonyl)amino]methyl]benzoate (PubChem CID 2381703) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is methyl 4-[[(1-phenyl-3-pyridin-3-ylpyrazole-4-carbonyl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[(1-phenyl-3-pyridin-3-ylpyrazole-4-carbonyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 2381703 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | methyl 4-[[(1-phenyl-3-pyridin-3-ylpyrazole-4-carbonyl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)c2cn(-c3ccccc3)nc2-c2cccnc2)cc1 |
| InChI | InChI=1S/C24H20N4O3/c1-31-24(30)18-11-9-17(10-12-18)14-26-23(29)21-16-28(20-7-3-2-4-8-20)27-22(21)19-6-5-13-25-15-19/h2-13,15-16H,14H2,1H3,(H,26,29) |
| InChIKey | QAIVLEFMHWVHSD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |