C26H23N5O2 — CID 17431965
N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide (PubChem CID 17431965) has the molecular formula C26H23N5O2 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide.
| Compound Name | N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 17431965 |
| Molecular Formula | C26H23N5O2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCCC2=O)cc1)c1cn(-c2ccccc2)nc1-c1cccnc1 |
| InChI | InChI=1S/C26H23N5O2/c32-24-9-5-15-30(24)21-12-10-19(11-13-21)16-28-26(33)23-18-31(22-7-2-1-3-8-22)29-25(23)20-6-4-14-27-17-20/h1-4,6-8,10-14,17-18H,5,9,15-16H2,(H,28,33) |
| InChIKey | YXAUHQSLQNZZFU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |