C25H29N3O6 — CID 35781681
4-butoxy-N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-3-methoxybenzohydrazide (PubChem CID 35781681) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is 4-butoxy-N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-3-methoxybenzohydrazide.
| Compound Name | 4-butoxy-N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 35781681 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 4-butoxy-N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-3-methoxybenzohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)c2ccccc2OCc2c(C)noc2C)cc1OC |
| InChI | InChI=1S/C25H29N3O6/c1-5-6-13-32-22-12-11-18(14-23(22)31-4)24(29)26-27-25(30)19-9-7-8-10-21(19)33-15-20-16(2)28-34-17(20)3/h7-12,14H,5-6,13,15H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | QKJLZSOAXRTDQY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|