C22H23N3O6 — CID 2093118
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxy-N'-(4-methoxybenzoyl)benzohydrazide (PubChem CID 2093118) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxy-N'-(4-methoxybenzoyl)benzohydrazide.
| Compound Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxy-N'-(4-methoxybenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 2093118 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxy-N'-(4-methoxybenzoyl)benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccc(OCc3c(C)noc3C)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H23N3O6/c1-13-18(14(2)31-25-13)12-30-19-10-7-16(11-20(19)29-4)22(27)24-23-21(26)15-5-8-17(28-3)9-6-15/h5-11H,12H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | XPFAZIYWCNJQNJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|